C26H27F3N2O6S — CID 22498348
dimethyl 4-[2-[4-(2-ethoxyphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1,3-dicarboxylate (PubChem CID 22498348) has the molecular formula C26H27F3N2O6S and a molecular weight of 552.57 g/mol. Its IUPAC name is dimethyl 4-[2-[4-(2-ethoxyphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1,3-dicarboxylate.
| Compound Name | dimethyl 4-[2-[4-(2-ethoxyphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22498348 |
| Molecular Formula | C26H27F3N2O6S |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | dimethyl 4-[2-[4-(2-ethoxyphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1,3-dicarboxylate |
| SMILES | C=C(C(=O)N1CCN(C(=O)OC)CC1C(=O)OC)c1ccc(Sc2ccccc2OCC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H27F3N2O6S/c1-5-37-20-8-6-7-9-22(20)38-21-11-10-17(14-18(21)26(27,28)29)16(2)23(32)31-13-12-30(25(34)36-4)15-19(31)24(33)35-3/h6-11,14,19H,2,5,12-13,15H2,1,3-4H3 |
| InChIKey | HXPHVGRKEZOMHN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|