C16H21F2NO3 — CID 95179553
[2-(difluoromethoxy)phenyl]-[(3S)-3-propoxypiperidin-1-yl]methanone (PubChem CID 95179553) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]-[(3S)-3-propoxypiperidin-1-yl]methanone.
| Compound Name | [2-(difluoromethoxy)phenyl]-[(3S)-3-propoxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95179553 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]-[(3S)-3-propoxypiperidin-1-yl]methanone |
| SMILES | CCCO[C@H]1CCCN(C(=O)c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C16H21F2NO3/c1-2-10-21-12-6-5-9-19(11-12)15(20)13-7-3-4-8-14(13)22-16(17)18/h3-4,7-8,12,16H,2,5-6,9-11H2,1H3/t12-/m0/s1 |
| InChIKey | CEYOKSVFZMLVMZ-LBPRGKRZSA-N |
| XLogP | 3.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |