C18H24F2N2O4 — CID 78862780
1-[2-(difluoromethoxy)benzoyl]-N-ethyl-N-(2-hydroxyethyl)piperidine-3-carboxamide (PubChem CID 78862780) has the molecular formula C18H24F2N2O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)benzoyl]-N-ethyl-N-(2-hydroxyethyl)piperidine-3-carboxamide.
| Compound Name | 1-[2-(difluoromethoxy)benzoyl]-N-ethyl-N-(2-hydroxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 78862780 |
| Molecular Formula | C18H24F2N2O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[2-(difluoromethoxy)benzoyl]-N-ethyl-N-(2-hydroxyethyl)piperidine-3-carboxamide |
| SMILES | CCN(CCO)C(=O)C1CCCN(C(=O)c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C18H24F2N2O4/c1-2-21(10-11-23)16(24)13-6-5-9-22(12-13)17(25)14-7-3-4-8-15(14)26-18(19)20/h3-4,7-8,13,18,23H,2,5-6,9-12H2,1H3 |
| InChIKey | UVQXTCGVJPPBAP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |