C15H17ClF3NO5 — CID 167783854
(3-chloro-2,4,5-trifluorophenyl)-[3,3,4,4-tetrakis(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 167783854) has the molecular formula C15H17ClF3NO5 and a molecular weight of 383.75 g/mol. Its IUPAC name is (3-chloro-2,4,5-trifluorophenyl)-[3,3,4,4-tetrakis(hydroxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-chloro-2,4,5-trifluorophenyl)-[3,3,4,4-tetrakis(hydroxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 167783854 |
| Molecular Formula | C15H17ClF3NO5 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (3-chloro-2,4,5-trifluorophenyl)-[3,3,4,4-tetrakis(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(F)c(Cl)c1F)N1CC(CO)(CO)C(CO)(CO)C1 |
| InChI | InChI=1S/C15H17ClF3NO5/c16-10-11(18)8(1-9(17)12(10)19)13(25)20-2-14(4-21,5-22)15(3-20,6-23)7-24/h1,21-24H,2-7H2 |
| InChIKey | PKORNXCSGNULQY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|