C10H7F4NO2 — CID 113375603
1,2-oxazolidin-2-yl-(2,3,4,5-tetrafluorophenyl)methanone (PubChem CID 113375603) has the molecular formula C10H7F4NO2 and a molecular weight of 249.16 g/mol. Its IUPAC name is 1,2-oxazolidin-2-yl-(2,3,4,5-tetrafluorophenyl)methanone.
| Compound Name | 1,2-oxazolidin-2-yl-(2,3,4,5-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 113375603 |
| Molecular Formula | C10H7F4NO2 |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1,2-oxazolidin-2-yl-(2,3,4,5-tetrafluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1F)N1CCCO1 |
| InChI | InChI=1S/C10H7F4NO2/c11-6-4-5(7(12)9(14)8(6)13)10(16)15-2-1-3-17-15/h4H,1-3H2 |
| InChIKey | KGSFLROUJHLNTG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|