C13H12F4N2O2 — CID 126825028
4-methyl-1-(2,3,4,5-tetrafluorobenzoyl)-1,4-diazepan-5-one (PubChem CID 126825028) has the molecular formula C13H12F4N2O2 and a molecular weight of 304.24 g/mol. Its IUPAC name is 4-methyl-1-(2,3,4,5-tetrafluorobenzoyl)-1,4-diazepan-5-one.
| Compound Name | 4-methyl-1-(2,3,4,5-tetrafluorobenzoyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 126825028 |
| Molecular Formula | C13H12F4N2O2 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-methyl-1-(2,3,4,5-tetrafluorobenzoyl)-1,4-diazepan-5-one |
| SMILES | CN1CCN(C(=O)c2cc(F)c(F)c(F)c2F)CCC1=O |
| InChI | InChI=1S/C13H12F4N2O2/c1-18-4-5-19(3-2-9(18)20)13(21)7-6-8(14)11(16)12(17)10(7)15/h6H,2-5H2,1H3 |
| InChIKey | SQEZVPLRUUOMNB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|