C8H9F2N3 — CID 61360850
N-amino-2,4-difluoro-N'-methylbenzenecarboximidamide (PubChem CID 61360850) has the molecular formula C8H9F2N3 and a molecular weight of 185.18 g/mol. Its IUPAC name is N-amino-2,4-difluoro-N'-methylbenzenecarboximidamide.
| Compound Name | N-amino-2,4-difluoro-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 61360850 |
| Molecular Formula | C8H9F2N3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | N-amino-2,4-difluoro-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\NN)c1ccc(F)cc1F |
| InChI | InChI=1S/C8H9F2N3/c1-12-8(13-11)6-3-2-5(9)4-7(6)10/h2-4H,11H2,1H3,(H,12,13) |
| InChIKey | LHUYSAVPCZHJBS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|