C14H19F2N3 — CID 61361337
N-amino-N'-cycloheptyl-2,4-difluorobenzenecarboximidamide (PubChem CID 61361337) has the molecular formula C14H19F2N3 and a molecular weight of 267.32 g/mol. Its IUPAC name is N-amino-N'-cycloheptyl-2,4-difluorobenzenecarboximidamide.
| Compound Name | N-amino-N'-cycloheptyl-2,4-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 61361337 |
| Molecular Formula | C14H19F2N3 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-amino-N'-cycloheptyl-2,4-difluorobenzenecarboximidamide |
| SMILES | NN/C(=N\C1CCCCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H19F2N3/c15-10-7-8-12(13(16)9-10)14(19-17)18-11-5-3-1-2-4-6-11/h7-9,11H,1-6,17H2,(H,18,19) |
| InChIKey | DHOOZRZMERCOMM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|