C10H13F2N3 — CID 61363069
N-amino-2,4-difluoro-N'-propan-2-ylbenzenecarboximidamide (PubChem CID 61363069) has the molecular formula C10H13F2N3 and a molecular weight of 213.23 g/mol. Its IUPAC name is N-amino-2,4-difluoro-N'-propan-2-ylbenzenecarboximidamide.
| Compound Name | N-amino-2,4-difluoro-N'-propan-2-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 61363069 |
| Molecular Formula | C10H13F2N3 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | N-amino-2,4-difluoro-N'-propan-2-ylbenzenecarboximidamide |
| SMILES | CC(C)/N=C(\NN)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H13F2N3/c1-6(2)14-10(15-13)8-4-3-7(11)5-9(8)12/h3-6H,13H2,1-2H3,(H,14,15) |
| InChIKey | DXOLNEKFHBPHLH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|