C16H18F2O4 — CID 15238264
[2-(acetyloxymethyl)-4-(2,4-difluorophenyl)pent-4-enyl] acetate (PubChem CID 15238264) has the molecular formula C16H18F2O4 and a molecular weight of 312.31 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-4-(2,4-difluorophenyl)pent-4-enyl] acetate.
| Compound Name | [2-(acetyloxymethyl)-4-(2,4-difluorophenyl)pent-4-enyl] acetate |
|---|---|
| PubChem CID | 15238264 |
| Molecular Formula | C16H18F2O4 |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [2-(acetyloxymethyl)-4-(2,4-difluorophenyl)pent-4-enyl] acetate |
| SMILES | C=C(CC(COC(C)=O)COC(C)=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H18F2O4/c1-10(15-5-4-14(17)7-16(15)18)6-13(8-21-11(2)19)9-22-12(3)20/h4-5,7,13H,1,6,8-9H2,2-3H3 |
| InChIKey | VXNHZGWNMOYMOB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |