C14H7F5N2O8S2 — CID 139941542
2-carbamoyl-6-[(4,5-difluoro-2-sulfobenzoyl)amino]-3,4,5-trifluorobenzenesulfonic acid (PubChem CID 139941542) has the molecular formula C14H7F5N2O8S2 and a molecular weight of 490.34 g/mol. Its IUPAC name is 2-carbamoyl-6-[(4,5-difluoro-2-sulfobenzoyl)amino]-3,4,5-trifluorobenzenesulfonic acid.
| Compound Name | 2-carbamoyl-6-[(4,5-difluoro-2-sulfobenzoyl)amino]-3,4,5-trifluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 139941542 |
| Molecular Formula | C14H7F5N2O8S2 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | 2-carbamoyl-6-[(4,5-difluoro-2-sulfobenzoyl)amino]-3,4,5-trifluorobenzenesulfonic acid |
| SMILES | NC(=O)c1c(F)c(F)c(F)c(NC(=O)c2cc(F)c(F)cc2S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C14H7F5N2O8S2/c15-4-1-3(6(2-5(4)16)30(24,25)26)14(23)21-11-10(19)9(18)8(17)7(13(20)22)12(11)31(27,28)29/h1-2H,(H2,20,22)(H,21,23)(H,24,25,26)(H,27,28,29) |
| InChIKey | NFDKFMHHKBNSGD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 180.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|