C11H8Cl3FO4S — CID 65397135
cyclopropylmethyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate (PubChem CID 65397135) has the molecular formula C11H8Cl3FO4S and a molecular weight of 361.61 g/mol. Its IUPAC name is cyclopropylmethyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate.
| Compound Name | cyclopropylmethyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate |
|---|---|
| PubChem CID | 65397135 |
| Molecular Formula | C11H8Cl3FO4S |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 359.92 |
| IUPAC Name | cyclopropylmethyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate |
| SMILES | O=C(OCC1CC1)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C11H8Cl3FO4S/c12-8-6(11(16)19-4-5-1-2-5)3-7(15)9(13)10(8)20(14,17)18/h3,5H,1-2,4H2 |
| InChIKey | ZEHOSHQLQDOELA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|