C12H11Cl2F2NO3S — CID 65370781
2-chloro-3-[cyclopropylmethyl(methyl)carbamoyl]-5,6-difluorobenzenesulfonyl chloride (PubChem CID 65370781) has the molecular formula C12H11Cl2F2NO3S and a molecular weight of 358.19 g/mol. Its IUPAC name is 2-chloro-3-[cyclopropylmethyl(methyl)carbamoyl]-5,6-difluorobenzenesulfonyl chloride.
| Compound Name | 2-chloro-3-[cyclopropylmethyl(methyl)carbamoyl]-5,6-difluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65370781 |
| Molecular Formula | C12H11Cl2F2NO3S |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 2-chloro-3-[cyclopropylmethyl(methyl)carbamoyl]-5,6-difluorobenzenesulfonyl chloride |
| SMILES | CN(CC1CC1)C(=O)c1cc(F)c(F)c(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C12H11Cl2F2NO3S/c1-17(5-6-2-3-6)12(18)7-4-8(15)10(16)11(9(7)13)21(14,19)20/h4,6H,2-3,5H2,1H3 |
| InChIKey | HXJFGWDHDNBCBD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|