C11H9Cl2F2NO3S — CID 65397980
2-chloro-5,6-difluoro-3-[(2-methylcyclopropyl)carbamoyl]benzenesulfonyl chloride (PubChem CID 65397980) has the molecular formula C11H9Cl2F2NO3S and a molecular weight of 344.17 g/mol. Its IUPAC name is 2-chloro-5,6-difluoro-3-[(2-methylcyclopropyl)carbamoyl]benzenesulfonyl chloride.
| Compound Name | 2-chloro-5,6-difluoro-3-[(2-methylcyclopropyl)carbamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65397980 |
| Molecular Formula | C11H9Cl2F2NO3S |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 2-chloro-5,6-difluoro-3-[(2-methylcyclopropyl)carbamoyl]benzenesulfonyl chloride |
| SMILES | CC1CC1NC(=O)c1cc(F)c(F)c(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C11H9Cl2F2NO3S/c1-4-2-7(4)16-11(17)5-3-6(14)9(15)10(8(5)12)20(13,18)19/h3-4,7H,2H2,1H3,(H,16,17) |
| InChIKey | KHGWUZJRPFZRRD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|