C13H13Cl3O4S — CID 66324019
cyclopentylmethyl 2,5-dichloro-3-chlorosulfonylbenzoate (PubChem CID 66324019) has the molecular formula C13H13Cl3O4S and a molecular weight of 371.67 g/mol. Its IUPAC name is cyclopentylmethyl 2,5-dichloro-3-chlorosulfonylbenzoate.
| Compound Name | cyclopentylmethyl 2,5-dichloro-3-chlorosulfonylbenzoate |
|---|---|
| PubChem CID | 66324019 |
| Molecular Formula | C13H13Cl3O4S |
| Molecular Weight | 371.67 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | cyclopentylmethyl 2,5-dichloro-3-chlorosulfonylbenzoate |
| SMILES | O=C(OCC1CCCC1)c1cc(Cl)cc(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C13H13Cl3O4S/c14-9-5-10(12(15)11(6-9)21(16,18)19)13(17)20-7-8-3-1-2-4-8/h5-6,8H,1-4,7H2 |
| InChIKey | TXLVHNWYCLADAY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |