C12H15Cl2FN2O3S — CID 65386227
N-butan-2-yl-2,4-dichloro-5-fluoro-N-methyl-3-sulfamoylbenzamide (PubChem CID 65386227) has the molecular formula C12H15Cl2FN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is N-butan-2-yl-2,4-dichloro-5-fluoro-N-methyl-3-sulfamoylbenzamide.
| Compound Name | N-butan-2-yl-2,4-dichloro-5-fluoro-N-methyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65386227 |
| Molecular Formula | C12H15Cl2FN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | N-butan-2-yl-2,4-dichloro-5-fluoro-N-methyl-3-sulfamoylbenzamide |
| SMILES | CCC(C)N(C)C(=O)c1cc(F)c(Cl)c(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C12H15Cl2FN2O3S/c1-4-6(2)17(3)12(18)7-5-8(15)10(14)11(9(7)13)21(16,19)20/h5-6H,4H2,1-3H3,(H2,16,19,20) |
| InChIKey | ZUIUYPBHIPKLIH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|