C10H12F2N2O4S2 — CID 113480656
2,4-difluoro-N-(2-methylsulfinylethyl)-5-sulfamoylbenzamide (PubChem CID 113480656) has the molecular formula C10H12F2N2O4S2 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-methylsulfinylethyl)-5-sulfamoylbenzamide.
| Compound Name | 2,4-difluoro-N-(2-methylsulfinylethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 113480656 |
| Molecular Formula | C10H12F2N2O4S2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2,4-difluoro-N-(2-methylsulfinylethyl)-5-sulfamoylbenzamide |
| SMILES | CS(=O)CCNC(=O)c1cc(S(N)(=O)=O)c(F)cc1F |
| InChI | InChI=1S/C10H12F2N2O4S2/c1-19(16)3-2-14-10(15)6-4-9(20(13,17)18)8(12)5-7(6)11/h4-5H,2-3H2,1H3,(H,14,15)(H2,13,17,18) |
| InChIKey | CBFFMJZGMYYNNS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |