C9H11F2N3O3S — CID 61094642
5-amino-2,4-difluoro-N-(2-sulfamoylethyl)benzamide (PubChem CID 61094642) has the molecular formula C9H11F2N3O3S and a molecular weight of 279.27 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-(2-sulfamoylethyl)benzamide.
| Compound Name | 5-amino-2,4-difluoro-N-(2-sulfamoylethyl)benzamide |
|---|---|
| PubChem CID | 61094642 |
| Molecular Formula | C9H11F2N3O3S |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 5-amino-2,4-difluoro-N-(2-sulfamoylethyl)benzamide |
| SMILES | Nc1cc(C(=O)NCCS(N)(=O)=O)c(F)cc1F |
| InChI | InChI=1S/C9H11F2N3O3S/c10-6-4-7(11)8(12)3-5(6)9(15)14-1-2-18(13,16)17/h3-4H,1-2,12H2,(H,14,15)(H2,13,16,17) |
| InChIKey | OILNAGIJBUSUIT-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|