C10H12ClFN2O3S — CID 47337136
4-chloro-2-fluoro-N-(3-sulfamoylpropyl)benzamide (PubChem CID 47337136) has the molecular formula C10H12ClFN2O3S and a molecular weight of 294.74 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-(3-sulfamoylpropyl)benzamide.
| Compound Name | 4-chloro-2-fluoro-N-(3-sulfamoylpropyl)benzamide |
|---|---|
| PubChem CID | 47337136 |
| Molecular Formula | C10H12ClFN2O3S |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 4-chloro-2-fluoro-N-(3-sulfamoylpropyl)benzamide |
| SMILES | NS(=O)(=O)CCCNC(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C10H12ClFN2O3S/c11-7-2-3-8(9(12)6-7)10(15)14-4-1-5-18(13,16)17/h2-3,6H,1,4-5H2,(H,14,15)(H2,13,16,17) |
| InChIKey | YMAFUTDVPDUCBX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|