C9H11FN2O2S — CID 115646483
3-fluoro-N-(2-methylsulfinylethyl)pyridine-4-carboxamide (PubChem CID 115646483) has the molecular formula C9H11FN2O2S and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-fluoro-N-(2-methylsulfinylethyl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-(2-methylsulfinylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115646483 |
| Molecular Formula | C9H11FN2O2S |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3-fluoro-N-(2-methylsulfinylethyl)pyridine-4-carboxamide |
| SMILES | CS(=O)CCNC(=O)c1ccncc1F |
| InChI | InChI=1S/C9H11FN2O2S/c1-15(14)5-4-12-9(13)7-2-3-11-6-8(7)10/h2-3,6H,4-5H2,1H3,(H,12,13) |
| InChIKey | VORJHNMRNRLNNK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |