C10H11F3N2O — CID 174890331
N,N'-dimethyl-N'-(trifluoromethyl)benzohydrazide (PubChem CID 174890331) has the molecular formula C10H11F3N2O and a molecular weight of 232.21 g/mol. Its IUPAC name is N,N'-dimethyl-N'-(trifluoromethyl)benzohydrazide.
| Compound Name | N,N'-dimethyl-N'-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 174890331 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N,N'-dimethyl-N'-(trifluoromethyl)benzohydrazide |
| SMILES | CN(C(=O)c1ccccc1)N(C)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O/c1-14(15(2)10(11,12)13)9(16)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | XKYSPXUSUMESPU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|