C11H12F3NO5 — CID 161381447
N,N-dimethoxybenzamide;2,2,2-trifluoroacetic acid (PubChem CID 161381447) has the molecular formula C11H12F3NO5 and a molecular weight of 295.21 g/mol. Its IUPAC name is N,N-dimethoxybenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethoxybenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161381447 |
| Molecular Formula | C11H12F3NO5 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N,N-dimethoxybenzamide;2,2,2-trifluoroacetic acid |
| SMILES | CON(OC)C(=O)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H11NO3.C2HF3O2/c1-12-10(13-2)9(11)8-6-4-3-5-7-8;3-2(4,5)1(6)7/h3-7H,1-2H3;(H,6,7) |
| InChIKey | VRTUFCDQKOWZOE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|