C15H18ClN3O — CID 68696600
N'-(4-aminophenyl)-N,N'-dimethylbenzohydrazide;hydrochloride (PubChem CID 68696600) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is N'-(4-aminophenyl)-N,N'-dimethylbenzohydrazide;hydrochloride.
| Compound Name | N'-(4-aminophenyl)-N,N'-dimethylbenzohydrazide;hydrochloride |
|---|---|
| PubChem CID | 68696600 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N'-(4-aminophenyl)-N,N'-dimethylbenzohydrazide;hydrochloride |
| SMILES | CN(C(=O)c1ccccc1)N(C)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C15H17N3O.ClH/c1-17(14-10-8-13(16)9-11-14)18(2)15(19)12-6-4-3-5-7-12;/h3-11H,16H2,1-2H3;1H |
| InChIKey | HOWOLYKMOPKUPV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|