About CID 173432275
CID 173432275 (PubChem CID 173432275) has the molecular formula C14H18GeNO4
and a molecular weight of 336.91 g/mol.
Molecular Properties
| Compound Name | CID 173432275 |
| PubChem CID | 173432275 |
| Molecular Formula | C14H18GeNO4 |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | — |
| SMILES | CN(C(=O)c1ccccc1)c1ccc([Ge])cc1.O.O.O |
| InChI | InChI=1S/C14H12GeNO.3H2O/c1-16(13-9-7-12(15)8-10-13)14(17)11-5-3-2-4-6-11;;;/h2-10H,1H3;3*1H2 |
| InChIKey | WFGQBNVDJRXVKG-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 114.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 173432275 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173432275?
The IUPAC name of CID 173432275 (CID 173432275) is not available.
What is the SMILES notation for CID 173432275?
The canonical SMILES for CID 173432275 is CN(C(=O)c1ccccc1)c1ccc([Ge])cc1.O.O.O.
What is the InChIKey of CID 173432275?
The InChIKey is WFGQBNVDJRXVKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12GeNO.3H2O/c1-16(13-9-7-12(15)8-10-13)14(17)11-5-3-2-4-6-11;;;/h2-10H,1H3;3*1H2.
What are the key properties of CID 173432275?
CID 173432275 has a molecular weight of 336.91 g/mol, XLogP of -0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173432275 is sourced from PubChem (CID 173432275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).