C16H14NO4- — CID 2360632
2-[4-[benzoyl(methyl)amino]phenoxy]acetate (PubChem CID 2360632) has the molecular formula C16H14NO4- and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[4-[benzoyl(methyl)amino]phenoxy]acetate.
| Compound Name | 2-[4-[benzoyl(methyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 2360632 |
| Molecular Formula | C16H14NO4- |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-[4-[benzoyl(methyl)amino]phenoxy]acetate |
| SMILES | CN(C(=O)c1ccccc1)c1ccc(OCC(=O)[O-])cc1 |
| InChI | InChI=1S/C16H15NO4/c1-17(16(20)12-5-3-2-4-6-12)13-7-9-14(10-8-13)21-11-15(18)19/h2-10H,11H2,1H3,(H,18,19)/p-1 |
| InChIKey | BXQPXKHBDUSPTQ-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |