C26H24NO5- — CID 165007461
4-[4-[4-[methyl-(4-methylbenzoyl)amino]phenoxy]-3-oxobutyl]benzoate (PubChem CID 165007461) has the molecular formula C26H24NO5- and a molecular weight of 430.48 g/mol. Its IUPAC name is 4-[4-[4-[methyl-(4-methylbenzoyl)amino]phenoxy]-3-oxobutyl]benzoate.
| Compound Name | 4-[4-[4-[methyl-(4-methylbenzoyl)amino]phenoxy]-3-oxobutyl]benzoate |
|---|---|
| PubChem CID | 165007461 |
| Molecular Formula | C26H24NO5- |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-[4-[4-[methyl-(4-methylbenzoyl)amino]phenoxy]-3-oxobutyl]benzoate |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(OCC(=O)CCc3ccc(C(=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C26H25NO5/c1-18-3-8-20(9-4-18)25(29)27(2)22-12-15-24(16-13-22)32-17-23(28)14-7-19-5-10-21(11-6-19)26(30)31/h3-6,8-13,15-16H,7,14,17H2,1-2H3,(H,30,31)/p-1 |
| InChIKey | JEJPMTBSSVOSHN-UHFFFAOYSA-M |
| XLogP | 3.22 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |