About benzoyl(methyl)carbamic acid;hydrochloride
benzoyl(methyl)carbamic acid;hydrochloride (PubChem CID 70634624) has the molecular formula C9H10ClNO3
and a molecular weight of 215.64 g/mol. Its IUPAC name is benzoyl(methyl)carbamic acid;hydrochloride.
Molecular Properties
| Compound Name | benzoyl(methyl)carbamic acid;hydrochloride |
| PubChem CID | 70634624 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | benzoyl(methyl)carbamic acid;hydrochloride |
| SMILES | CN(C(=O)O)C(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C9H9NO3.ClH/c1-10(9(12)13)8(11)7-5-3-2-4-6-7;/h2-6H,1H3,(H,12,13);1H |
| InChIKey | ONCPEEPMWBSEBG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzoyl(methyl)carbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl(methyl)carbamic acid;hydrochloride?
The IUPAC name of benzoyl(methyl)carbamic acid;hydrochloride (CID 70634624) is benzoyl(methyl)carbamic acid;hydrochloride.
What is the SMILES notation for benzoyl(methyl)carbamic acid;hydrochloride?
The canonical SMILES for benzoyl(methyl)carbamic acid;hydrochloride is CN(C(=O)O)C(=O)c1ccccc1.Cl.
What is the InChIKey of benzoyl(methyl)carbamic acid;hydrochloride?
The InChIKey is ONCPEEPMWBSEBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3.ClH/c1-10(9(12)13)8(11)7-5-3-2-4-6-7;/h2-6H,1H3,(H,12,13);1H.
What are the key properties of benzoyl(methyl)carbamic acid;hydrochloride?
benzoyl(methyl)carbamic acid;hydrochloride has a molecular weight of 215.64 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl(methyl)carbamic acid;hydrochloride is sourced from PubChem (CID 70634624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).