About CID 19990303
CID 19990303 (PubChem CID 19990303) has the molecular formula C19H22N2O3Si
and a molecular weight of 354.48 g/mol.
Molecular Properties
| Compound Name | CID 19990303 |
| PubChem CID | 19990303 |
| Molecular Formula | C19H22N2O3Si |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | — |
| SMILES | CCO[Si]C(N(C)C(=O)c1ccccc1)N(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3Si/c1-4-24-25-19(20(2)17(22)15-11-7-5-8-12-15)21(3)18(23)16-13-9-6-10-14-16/h5-14,19H,4H2,1-3H3 |
| InChIKey | ROFVWUAWGZGLIC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 19990303 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19990303?
The IUPAC name of CID 19990303 (CID 19990303) is not available.
What is the SMILES notation for CID 19990303?
The canonical SMILES for CID 19990303 is CCO[Si]C(N(C)C(=O)c1ccccc1)N(C)C(=O)c1ccccc1.
What is the InChIKey of CID 19990303?
The InChIKey is ROFVWUAWGZGLIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3Si/c1-4-24-25-19(20(2)17(22)15-11-7-5-8-12-15)21(3)18(23)16-13-9-6-10-14-16/h5-14,19H,4H2,1-3H3.
What are the key properties of CID 19990303?
CID 19990303 has a molecular weight of 354.48 g/mol, XLogP of 2.47, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19990303 is sourced from PubChem (CID 19990303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).