C12H12F3NO — CID 61410101
N-cyclopropyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 61410101) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is N-cyclopropyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-cyclopropyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 61410101 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-cyclopropyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(c1ccccc1)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H12F3NO/c13-12(14,15)8-16(10-6-7-10)11(17)9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | NUHRXELXGMOGLA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |