C18H24F3NO2 — CID 90554705
4-tert-butyl-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 90554705) has the molecular formula C18H24F3NO2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-tert-butyl-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-tert-butyl-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 90554705 |
| Molecular Formula | C18H24F3NO2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 4-tert-butyl-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N(CC(F)(F)F)C2CCOCC2)cc1 |
| InChI | InChI=1S/C18H24F3NO2/c1-17(2,3)14-6-4-13(5-7-14)16(23)22(12-18(19,20)21)15-8-10-24-11-9-15/h4-7,15H,8-12H2,1-3H3 |
| InChIKey | LQQLJQPOSNETNU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |