C20H21Cl2N3O3 — CID 19752989
N-tert-butyl-2,4-dichloro-N'-ethyl-N'-(4-nitrosobenzoyl)benzohydrazide (PubChem CID 19752989) has the molecular formula C20H21Cl2N3O3 and a molecular weight of 422.31 g/mol. Its IUPAC name is N-tert-butyl-2,4-dichloro-N'-ethyl-N'-(4-nitrosobenzoyl)benzohydrazide.
| Compound Name | N-tert-butyl-2,4-dichloro-N'-ethyl-N'-(4-nitrosobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 19752989 |
| Molecular Formula | C20H21Cl2N3O3 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-tert-butyl-2,4-dichloro-N'-ethyl-N'-(4-nitrosobenzoyl)benzohydrazide |
| SMILES | CCN(C(=O)c1ccc(N=O)cc1)N(C(=O)c1ccc(Cl)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C20H21Cl2N3O3/c1-5-24(18(26)13-6-9-15(23-28)10-7-13)25(20(2,3)4)19(27)16-11-8-14(21)12-17(16)22/h6-12H,5H2,1-4H3 |
| InChIKey | FXORWCDBROMOBZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|