C22H29BCl2N2O4 — CID 161427394
4-chloro-N,N-diethylbenzamide;[5-chloro-2-(diethylcarbamoyl)phenyl]boronic acid (PubChem CID 161427394) has the molecular formula C22H29BCl2N2O4 and a molecular weight of 467.20 g/mol. Its IUPAC name is 4-chloro-N,N-diethylbenzamide;[5-chloro-2-(diethylcarbamoyl)phenyl]boronic acid.
| Compound Name | 4-chloro-N,N-diethylbenzamide;[5-chloro-2-(diethylcarbamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 161427394 |
| Molecular Formula | C22H29BCl2N2O4 |
| Molecular Weight | 467.20 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 4-chloro-N,N-diethylbenzamide;[5-chloro-2-(diethylcarbamoyl)phenyl]boronic acid |
| SMILES | CCN(CC)C(=O)c1ccc(Cl)cc1.CCN(CC)C(=O)c1ccc(Cl)cc1B(O)O |
| InChI | InChI=1S/C11H15BClNO3.C11H14ClNO/c1-3-14(4-2)11(15)9-6-5-8(13)7-10(9)12(16)17;1-3-13(4-2)11(14)9-5-7-10(12)8-6-9/h5-7,16-17H,3-4H2,1-2H3;5-8H,3-4H2,1-2H3 |
| InChIKey | VXNWEVLWAWCVSW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|