C20H26ClNO3 — CID 66680099
methyl 5-chloro-2-(spiro[5.5]undecane-4-carbonylamino)benzoate (PubChem CID 66680099) has the molecular formula C20H26ClNO3 and a molecular weight of 363.89 g/mol. Its IUPAC name is methyl 5-chloro-2-(spiro[5.5]undecane-4-carbonylamino)benzoate.
| Compound Name | methyl 5-chloro-2-(spiro[5.5]undecane-4-carbonylamino)benzoate |
|---|---|
| PubChem CID | 66680099 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 5-chloro-2-(spiro[5.5]undecane-4-carbonylamino)benzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1NC(=O)C1CCCC2(CCCCC2)C1 |
| InChI | InChI=1S/C20H26ClNO3/c1-25-19(24)16-12-15(21)7-8-17(16)22-18(23)14-6-5-11-20(13-14)9-3-2-4-10-20/h7-8,12,14H,2-6,9-11,13H2,1H3,(H,22,23) |
| InChIKey | MYHVFZBMLLXTHV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |