C20H18Cl2F2N2O2 — CID 60594428
1-N,3-N-bis(4-chloro-2-fluorophenyl)cyclohexane-1,3-dicarboxamide (PubChem CID 60594428) has the molecular formula C20H18Cl2F2N2O2 and a molecular weight of 427.28 g/mol. Its IUPAC name is 1-N,3-N-bis(4-chloro-2-fluorophenyl)cyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(4-chloro-2-fluorophenyl)cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 60594428 |
| Molecular Formula | C20H18Cl2F2N2O2 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 1-N,3-N-bis(4-chloro-2-fluorophenyl)cyclohexane-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)C1CCCC(C(=O)Nc2ccc(Cl)cc2F)C1 |
| InChI | InChI=1S/C20H18Cl2F2N2O2/c21-13-4-6-17(15(23)9-13)25-19(27)11-2-1-3-12(8-11)20(28)26-18-7-5-14(22)10-16(18)24/h4-7,9-12H,1-3,8H2,(H,25,27)(H,26,28) |
| InChIKey | DCWAEUOQIHWFRT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |