C25H23ClN2O5 — CID 66680441
methyl 5-chloro-2-[[1-[3-(furan-3-yl)benzoyl]piperidine-3-carbonyl]amino]benzoate (PubChem CID 66680441) has the molecular formula C25H23ClN2O5 and a molecular weight of 466.92 g/mol. Its IUPAC name is methyl 5-chloro-2-[[1-[3-(furan-3-yl)benzoyl]piperidine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 5-chloro-2-[[1-[3-(furan-3-yl)benzoyl]piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 66680441 |
| Molecular Formula | C25H23ClN2O5 |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | methyl 5-chloro-2-[[1-[3-(furan-3-yl)benzoyl]piperidine-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1NC(=O)C1CCCN(C(=O)c2cccc(-c3ccoc3)c2)C1 |
| InChI | InChI=1S/C25H23ClN2O5/c1-32-25(31)21-13-20(26)7-8-22(21)27-23(29)18-6-3-10-28(14-18)24(30)17-5-2-4-16(12-17)19-9-11-33-15-19/h2,4-5,7-9,11-13,15,18H,3,6,10,14H2,1H3,(H,27,29) |
| InChIKey | GRWMQTDIKYANBG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |