C22H20ClNO5 — CID 66679964
methyl 5-chloro-2-[[2-[3-(furan-3-yl)phenoxy]-2-methylpropanoyl]amino]benzoate (PubChem CID 66679964) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is methyl 5-chloro-2-[[2-[3-(furan-3-yl)phenoxy]-2-methylpropanoyl]amino]benzoate.
| Compound Name | methyl 5-chloro-2-[[2-[3-(furan-3-yl)phenoxy]-2-methylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 66679964 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | methyl 5-chloro-2-[[2-[3-(furan-3-yl)phenoxy]-2-methylpropanoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1NC(=O)C(C)(C)Oc1cccc(-c2ccoc2)c1 |
| InChI | InChI=1S/C22H20ClNO5/c1-22(2,29-17-6-4-5-14(11-17)15-9-10-28-13-15)21(26)24-19-8-7-16(23)12-18(19)20(25)27-3/h4-13H,1-3H3,(H,24,26) |
| InChIKey | QBMQAKSIYHFHEZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |