C20H16ClNO5 — CID 142738111
5-chloro-2-[[2-[3-(furan-3-yl)phenoxy]acetyl]amino]-3-methylbenzoic acid (PubChem CID 142738111) has the molecular formula C20H16ClNO5 and a molecular weight of 385.80 g/mol. Its IUPAC name is 5-chloro-2-[[2-[3-(furan-3-yl)phenoxy]acetyl]amino]-3-methylbenzoic acid.
| Compound Name | 5-chloro-2-[[2-[3-(furan-3-yl)phenoxy]acetyl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 142738111 |
| Molecular Formula | C20H16ClNO5 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 5-chloro-2-[[2-[3-(furan-3-yl)phenoxy]acetyl]amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(Cl)cc(C(=O)O)c1NC(=O)COc1cccc(-c2ccoc2)c1 |
| InChI | InChI=1S/C20H16ClNO5/c1-12-7-15(21)9-17(20(24)25)19(12)22-18(23)11-27-16-4-2-3-13(8-16)14-5-6-26-10-14/h2-10H,11H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | AUQUSBUKEMAZGM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |