C18H19Cl2NO2 — CID 7467237
2-(3,5-dichlorophenoxy)-N-(2,6-diethylphenyl)acetamide (PubChem CID 7467237) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-(3,5-dichlorophenoxy)-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 7467237 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)COc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2NO2/c1-3-12-6-5-7-13(4-2)18(12)21-17(22)11-23-16-9-14(19)8-15(20)10-16/h5-10H,3-4,11H2,1-2H3,(H,21,22) |
| InChIKey | MMOFHDIIORJZMJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |