C18H17F4NO2 — CID 7467725
N-(2,6-diethylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide (PubChem CID 7467725) has the molecular formula C18H17F4NO2 and a molecular weight of 355.33 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 7467725 |
| Molecular Formula | C18H17F4NO2 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C18H17F4NO2/c1-3-10-6-5-7-11(4-2)17(10)23-14(24)9-25-18-15(21)12(19)8-13(20)16(18)22/h5-8H,3-4,9H2,1-2H3,(H,23,24) |
| InChIKey | NDGIWBQKSZBTCY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|