C14H8BrF4NO2 — CID 2558535
N-(2-bromophenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide (PubChem CID 2558535) has the molecular formula C14H8BrF4NO2 and a molecular weight of 378.12 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 2558535 |
| Molecular Formula | C14H8BrF4NO2 |
| Molecular Weight | 378.12 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | N-(2-bromophenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
| SMILES | O=C(COc1c(F)c(F)cc(F)c1F)Nc1ccccc1Br |
| InChI | InChI=1S/C14H8BrF4NO2/c15-7-3-1-2-4-10(7)20-11(21)6-22-14-12(18)8(16)5-9(17)13(14)19/h1-5H,6H2,(H,20,21) |
| InChIKey | RAPDDMOAUASTJT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.12 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|