C15H13Br2NO3 — CID 63052653
2-[2-bromo-4-(hydroxymethyl)phenoxy]-N-(2-bromophenyl)acetamide (PubChem CID 63052653) has the molecular formula C15H13Br2NO3 and a molecular weight of 415.08 g/mol. Its IUPAC name is 2-[2-bromo-4-(hydroxymethyl)phenoxy]-N-(2-bromophenyl)acetamide.
| Compound Name | 2-[2-bromo-4-(hydroxymethyl)phenoxy]-N-(2-bromophenyl)acetamide |
|---|---|
| PubChem CID | 63052653 |
| Molecular Formula | C15H13Br2NO3 |
| Molecular Weight | 415.08 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | 2-[2-bromo-4-(hydroxymethyl)phenoxy]-N-(2-bromophenyl)acetamide |
| SMILES | O=C(COc1ccc(CO)cc1Br)Nc1ccccc1Br |
| InChI | InChI=1S/C15H13Br2NO3/c16-11-3-1-2-4-13(11)18-15(20)9-21-14-6-5-10(8-19)7-12(14)17/h1-7,19H,8-9H2,(H,18,20) |
| InChIKey | CNUNYTUTEKANTL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.08 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |