C15H13BrClNO3 — CID 1213643
2-(2-bromo-4-chlorophenoxy)-N-[2-(hydroxymethyl)phenyl]acetamide (PubChem CID 1213643) has the molecular formula C15H13BrClNO3 and a molecular weight of 370.63 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-[2-(hydroxymethyl)phenyl]acetamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-[2-(hydroxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1213643 |
| Molecular Formula | C15H13BrClNO3 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-[2-(hydroxymethyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Br)Nc1ccccc1CO |
| InChI | InChI=1S/C15H13BrClNO3/c16-12-7-11(17)5-6-14(12)21-9-15(20)18-13-4-2-1-3-10(13)8-19/h1-7,19H,8-9H2,(H,18,20) |
| InChIKey | GIDGRARSXMJJBR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |