C15H14BrClN2O3 — CID 34877130
2-(2-bromo-4-chlorophenoxy)-N-(2-ethoxy-3-pyridinyl)acetamide (PubChem CID 34877130) has the molecular formula C15H14BrClN2O3 and a molecular weight of 385.65 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-(2-ethoxy-3-pyridinyl)acetamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-(2-ethoxy-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 34877130 |
| Molecular Formula | C15H14BrClN2O3 |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-(2-ethoxy-3-pyridinyl)acetamide |
| SMILES | CCOc1ncccc1NC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C15H14BrClN2O3/c1-2-21-15-12(4-3-7-18-15)19-14(20)9-22-13-6-5-10(17)8-11(13)16/h3-8H,2,9H2,1H3,(H,19,20) |
| InChIKey | AFGAUTLAOSIYDM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |