C18H18BrClN2O4 — CID 17150278
2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 17150278) has the molecular formula C18H18BrClN2O4 and a molecular weight of 441.71 g/mol. Its IUPAC name is 2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 17150278 |
| Molecular Formula | C18H18BrClN2O4 |
| Molecular Weight | 441.71 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 2-[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccccc1NC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C18H18BrClN2O4/c1-25-9-8-21-18(24)13-4-2-3-5-15(13)22-17(23)11-26-16-7-6-12(20)10-14(16)19/h2-7,10H,8-9,11H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | QPJKPGDGDUQFHL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.71 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|