C24H24BrNO4 — CID 17130889
2-(2-bromo-4-ethylphenoxy)-N-[2-(2-phenoxyethoxy)phenyl]acetamide (PubChem CID 17130889) has the molecular formula C24H24BrNO4 and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-(2-bromo-4-ethylphenoxy)-N-[2-(2-phenoxyethoxy)phenyl]acetamide.
| Compound Name | 2-(2-bromo-4-ethylphenoxy)-N-[2-(2-phenoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 17130889 |
| Molecular Formula | C24H24BrNO4 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-(2-bromo-4-ethylphenoxy)-N-[2-(2-phenoxyethoxy)phenyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)Nc2ccccc2OCCOc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C24H24BrNO4/c1-2-18-12-13-22(20(25)16-18)30-17-24(27)26-21-10-6-7-11-23(21)29-15-14-28-19-8-4-3-5-9-19/h3-13,16H,2,14-15,17H2,1H3,(H,26,27) |
| InChIKey | RKRRKSMMVDYNNP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|