C23H22BrNO4 — CID 17130878
2-(4-bromo-3-methylphenoxy)-N-[2-(2-phenoxyethoxy)phenyl]acetamide (PubChem CID 17130878) has the molecular formula C23H22BrNO4 and a molecular weight of 456.34 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)-N-[2-(2-phenoxyethoxy)phenyl]acetamide.
| Compound Name | 2-(4-bromo-3-methylphenoxy)-N-[2-(2-phenoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 17130878 |
| Molecular Formula | C23H22BrNO4 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)-N-[2-(2-phenoxyethoxy)phenyl]acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccccc2OCCOc2ccccc2)ccc1Br |
| InChI | InChI=1S/C23H22BrNO4/c1-17-15-19(11-12-20(17)24)29-16-23(26)25-21-9-5-6-10-22(21)28-14-13-27-18-7-3-2-4-8-18/h2-12,15H,13-14,16H2,1H3,(H,25,26) |
| InChIKey | AWMZRBFZFMGUDW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|