C15H11F4NO2S — CID 112778206
N-(3-methylsulfanylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide (PubChem CID 112778206) has the molecular formula C15H11F4NO2S and a molecular weight of 345.32 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 112778206 |
| Molecular Formula | C15H11F4NO2S |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
| SMILES | CSc1cccc(NC(=O)COc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C15H11F4NO2S/c1-23-9-4-2-3-8(5-9)20-12(21)7-22-15-13(18)10(16)6-11(17)14(15)19/h2-6H,7H2,1H3,(H,20,21) |
| InChIKey | CRAJOIYDJYBWQQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|