C22H28ClNO2 — CID 16545130
2-(4-chloro-3-ethylphenoxy)-N-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 16545130) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is 2-(4-chloro-3-ethylphenoxy)-N-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-(4-chloro-3-ethylphenoxy)-N-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 16545130 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-(4-chloro-3-ethylphenoxy)-N-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CCc1cc(OCC(=O)Nc2c(C(C)C)cccc2C(C)C)ccc1Cl |
| InChI | InChI=1S/C22H28ClNO2/c1-6-16-12-17(10-11-20(16)23)26-13-21(25)24-22-18(14(2)3)8-7-9-19(22)15(4)5/h7-12,14-15H,6,13H2,1-5H3,(H,24,25) |
| InChIKey | PVCRURHUISKBOP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |