C16H15BrClNO2 — CID 7917215
N-(3-bromophenyl)-2-(4-chloro-3-ethylphenoxy)acetamide (PubChem CID 7917215) has the molecular formula C16H15BrClNO2 and a molecular weight of 368.66 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(4-chloro-3-ethylphenoxy)acetamide.
| Compound Name | N-(3-bromophenyl)-2-(4-chloro-3-ethylphenoxy)acetamide |
|---|---|
| PubChem CID | 7917215 |
| Molecular Formula | C16H15BrClNO2 |
| Molecular Weight | 368.66 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | N-(3-bromophenyl)-2-(4-chloro-3-ethylphenoxy)acetamide |
| SMILES | CCc1cc(OCC(=O)Nc2cccc(Br)c2)ccc1Cl |
| InChI | InChI=1S/C16H15BrClNO2/c1-2-11-8-14(6-7-15(11)18)21-10-16(20)19-13-5-3-4-12(17)9-13/h3-9H,2,10H2,1H3,(H,19,20) |
| InChIKey | OQTLDKCBGHLINP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |