C14H7BrCl5NO2 — CID 19178145
N-(3-bromophenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide (PubChem CID 19178145) has the molecular formula C14H7BrCl5NO2 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide.
| Compound Name | N-(3-bromophenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19178145 |
| Molecular Formula | C14H7BrCl5NO2 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 474.81 |
| IUPAC Name | N-(3-bromophenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
| SMILES | O=C(COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C14H7BrCl5NO2/c15-6-2-1-3-7(4-6)21-8(22)5-23-14-12(19)10(17)9(16)11(18)13(14)20/h1-4H,5H2,(H,21,22) |
| InChIKey | RBOXRFFWIAWTLO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|